ethyl diatrizoate
Modify Date: 2025-08-26 10:39:53
ethyl diatrizoate structure
|
Common Name | ethyl diatrizoate | ||
|---|---|---|---|---|
| CAS Number | 2168-75-4 | Molecular Weight | 641.96700 | |
| Density | 2.324g/cm3 | Boiling Point | 611.6ºC at 760mmHg | |
| Molecular Formula | C13H13I3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.7ºC | |
| Name | ethyl 3,5-diacetamido-2,4,6-triiodobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.324g/cm3 |
|---|---|
| Boiling Point | 611.6ºC at 760mmHg |
| Molecular Formula | C13H13I3N2O4 |
| Molecular Weight | 641.96700 |
| Flash Point | 323.7ºC |
| Exact Mass | 641.80100 |
| PSA | 91.48000 |
| LogP | 4.89290 |
| Vapour Pressure | 6.77E-15mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | OBISGMNJKBVZBT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(I)c(NC(C)=O)c(I)c(NC(C)=O)c1I |
| HS Code | 2924299090 |
|---|
|
~92%
ethyl diatrizoate CAS#:2168-75-4 |
| Literature: Toner, John Luke; Wolf, Gerald Lee; Simmons, Daryl Michael; McIntire, Gregory Lyan; Bacon, Edward Richard; Illio, Kathleen Patent: US2005/265923 A1, 2005 ; Location in patent: Page/Page column 7 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Win 8883 |
| ethyl-3,5-diacetamido-2,4,6-triiodobenzoate |
| Ethyl diatrizoate |
| Benzoic acid,3,5-diacetamido-2,4,6-triiodo-,ethyl ester |
| ethyl-3,5-diacetoamido-2,4,6-triiodobenzoate |
| 3,5-Bis-acetylamino-2,4,6-triiodo-benzoic acid ethyl ester |
| ethyl-3,5-bisacetoamido-2,4,6-triiodobenzoate |