N3-D-Orn(Boc)-OH
Modify Date: 2024-01-30 17:34:04
N3-D-Orn(Boc)-OH structure
|
Common Name | N3-D-Orn(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 2165877-62-1 | Molecular Weight | 258.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-D-Orn(Boc)-OHN3-D-Orn(Boc)-OH is a Boc-protected pentanoic amino acid derivative, can be used as a click chemistry reagent and has been used to synthesis antibody-drug conjugates (ADC)[1]. |
| Name | N3-D-Orn(Boc)-OH |
|---|
| Description | N3-D-Orn(Boc)-OH is a Boc-protected pentanoic amino acid derivative, can be used as a click chemistry reagent and has been used to synthesis antibody-drug conjugates (ADC)[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C10H18N4O4 |
|---|---|
| Molecular Weight | 258.27 |