8-Bromomethyl-4,4-difluoro-1,3,5,7-tetramethyl- 4-bora-3a,4a-diaza-s-indacene structure
|
Common Name | 8-Bromomethyl-4,4-difluoro-1,3,5,7-tetramethyl- 4-bora-3a,4a-diaza-s-indacene | ||
|---|---|---|---|---|
| CAS Number | 216434-81-0 | Molecular Weight | 341.002 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BBrF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 8-Bromomethyl-4,4-difluoro-1,3,5,7-tetramethyl- 4-bora-3a,4a-diaza-s-indaceneBODIPY 493/503 methyl bromide, a green fluorescent dye, is a cell permeable and long-term staining agent (Ex=521 nm, Em=538 nm)[1]. |
| Name | 8-Bromomethyl-4,4-difluoro-1,3,5,7-tetramethyl- 4-bora-3a,4a-diaza-s-indacene |
|---|---|
| Synonym | More Synonyms |
| Description | BODIPY 493/503 methyl bromide, a green fluorescent dye, is a cell permeable and long-term staining agent (Ex=521 nm, Em=538 nm)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H16BBrF2N2 |
|---|---|
| Molecular Weight | 341.002 |
| Exact Mass | 340.055786 |
| PSA | 13.32000 |
| LogP | 3.20150 |
| InChIKey | JLSHPOSUMKVMAP-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)=[N+]2C1=C(CBr)c1c(C)cc(C)n1[B-]2(F)F |
| 8-bromomethyl-4,4-difluoro-1,3,5,7-tetramethyl-4-bora-3a,4a-diaza-s-indacene |
| Boron, [2-[2-bromo-1-(3,5-dimethyl-2H-pyrrol-2-ylidene-κN)ethyl]-3,5-dimethyl-1H-pyrrolato-κN]difluoro- |
| {2-[2-Bromo-1-(3,5-dimethyl-2H-pyrrol-2-ylidene-κN)ethyl]-3,5-dimethyl-1H-pyrrolato-κN}(difluoro)boron |