5-Bromo-6-chloropyridine-3-sulfonyl chloride
Modify Date: 2025-08-25 23:52:35
5-Bromo-6-chloropyridine-3-sulfonyl chloride structure
|
Common Name | 5-Bromo-6-chloropyridine-3-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 216394-05-7 | Molecular Weight | 290.950 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 352.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C5H2BrCl2NO2S | Melting Point | 71-73°C | |
| MSDS | USA | Flash Point | 167.2±27.9 °C | |
| Name | 5-Bromo-6-chloropyridine-3-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.8±42.0 °C at 760 mmHg |
| Melting Point | 71-73°C |
| Molecular Formula | C5H2BrCl2NO2S |
| Molecular Weight | 290.950 |
| Flash Point | 167.2±27.9 °C |
| Exact Mass | 288.836670 |
| PSA | 55.41000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | TURGMVYIESHZBE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cnc(Cl)c(Br)c1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3261 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2933399090 |
|
~99%
5-Bromo-6-chlor... CAS#:216394-05-7 |
| Literature: Crosignani, Stefano; Pretre, Adeline; Jorand-Lebrun, Catherine; Fraboulet, Gaele; Seenisamy, Jeyaprakashnarayanan; Augustine, John Kallikat; Missotten, Marc; Humbert, Yves; Cleva, Christophe; Abla, Nada; Daff, Hamina; Schott, Olivier; Schneider, Manfred; Burgat-Charvillon, Fabienne; Rivron, Delphine; Hamernig, Ingrid; Arrighi, Jean-Francois; Gaudet, Marilene; Zimmerli, Simone C.; Juillard, Pierre; Johnson, Zoe Journal of Medicinal Chemistry, 2011 , vol. 54, # 20 p. 7299 - 7317 |
|
~%
5-Bromo-6-chlor... CAS#:216394-05-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 1 p. 498 - 509 |
|
~%
5-Bromo-6-chlor... CAS#:216394-05-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 1 p. 498 - 509 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-bromo-6-chloro-pyridine-3-sulfonyl chloride |
| 3-BROMO-2-CHLOROPYRIDINE-5-SULPHONYL CHLORIDE |
| 2-chloro-3-bromopyridin-5-ylsulfonyl chloride |
| MFCD01318107 |
| 3-Pyridinesulfonyl chloride, 5-bromo-6-chloro- |
| 3-bromo-2-chloropyridine-5-sulfonyl chloride |
| 5-Bromo-6-chloro-3-pyridinesulfonyl chloride |
| pyridine-3-bromo-2-chloro-5-sulphonyl chloride |
| 5-Brom-6-chlor-pyridin-3-sulfonylchlorid |
| 5-bromo-6-chloropyridine-3-sulfonyl chloride |