phenyl hydrogen phenylmalonate structure
|
Common Name | phenyl hydrogen phenylmalonate | ||
|---|---|---|---|---|
| CAS Number | 21601-78-5 | Molecular Weight | 256.25300 | |
| Density | 1.283g/cm3 | Boiling Point | 446.5ºC at 760mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2ºC | |
| Name | 3-oxo-3-phenoxy-2-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 446.5ºC at 760mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 170.2ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.46040 |
| Vapour Pressure | 9.32E-09mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | IDJNJFYWPMDFNB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(=O)Oc1ccccc1)c1ccccc1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Phenylmalonsaeuremonophenylester |
| EINECS 244-470-7 |
| Phenylmalonsaeurephenylester |
| Monophenyl-phenylmalonat |
| phenyl hydrogen phenylmalonate |
| phenylmalonic acid monophenyl ester |