octyl phenyl hydrogen phosphate
Modify Date: 2025-11-09 16:35:30
octyl phenyl hydrogen phosphate structure
|
Common Name | octyl phenyl hydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 10581-14-3 | Molecular Weight | 286.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | octyl phenyl hydrogen phosphate |
|---|
| Molecular Formula | C14H23O4P |
|---|---|
| Molecular Weight | 286.30400 |
| Exact Mass | 286.13300 |
| PSA | 65.57000 |
| LogP | 4.54290 |
| InChIKey | SDWUQIDETLBAIU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOP(=O)(O)Oc1ccccc1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |