3-(acetyloxymethyl)-8-oxo-7-[(2-pyridin-2-ylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid structure
|
Common Name | 3-(acetyloxymethyl)-8-oxo-7-[(2-pyridin-2-ylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 21593-22-6 | Molecular Weight | 423.46300 | |
| Density | 1.57g/cm3 | Boiling Point | 783.9ºC at 760 mmHg | |
| Molecular Formula | C17H17N3O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 427.9ºC | |
| Name | 3-(acetyloxymethyl)-8-oxo-7-[(2-pyridin-2-ylsulfanylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 783.9ºC at 760 mmHg |
| Molecular Formula | C17H17N3O6S2 |
| Molecular Weight | 423.46300 |
| Flash Point | 427.9ºC |
| Exact Mass | 423.05600 |
| PSA | 176.50000 |
| LogP | 0.80420 |
| Vapour Pressure | 6.98E-26mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | HTQGXEDPVLPVPW-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)CSc3ccccn3)C2SC1 |
|
~%
3-(acetyloxymet... CAS#:21593-22-6 |
| Literature: Crast,L.B. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1413 - 1415 |
|
~%
3-(acetyloxymet... CAS#:21593-22-6 |
| Literature: Crast,L.B. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 1413 - 1415 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |