2,6-dimethylphenylmagnesium bromide structure
|
Common Name | 2,6-dimethylphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 21450-64-6 | Molecular Weight | 209.36600 | |
| Density | 0.998 g/mL at 25 °C | Boiling Point | 65-67 °C | |
| Molecular Formula | C8H9BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | −2 °F | |
| Name | magnesium,1,3-dimethylbenzene-2-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.998 g/mL at 25 °C |
|---|---|
| Boiling Point | 65-67 °C |
| Molecular Formula | C8H9BrMg |
| Molecular Weight | 209.36600 |
| Flash Point | −2 °F |
| Exact Mass | 207.97400 |
| LogP | 2.94920 |
| Appearance of Characters | Solution | Colorless to yellow-brown |
| Vapour Pressure | 7.61mmHg at 25°C |
| InChIKey | DCQJQVFIEFMTTQ-UHFFFAOYSA-M |
| SMILES | Cc1[c-]c(C)ccc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | 11-14-19-20/21/22-34 |
| Safety Phrases | 16-23-26-36/37/39-45 |
| RIDADR | UN 3399 4.3/PG 2 |
| HS Code | 2931900090 |
|
~%
2,6-dimethylphe... CAS#:21450-64-6 |
| Literature: Journal of Organic Chemistry, , vol. 65, # 10 p. 3154 - 3159 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Dimethylphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| MFCD00192083 |
| 2,6-Dimethylphenylmagnesium bromide |
| 2,6-Me2C6H3MgBr |
| 2,6-dimethylphenyl MgBr |
| 2,6-dimethylphenyl-magnesium bromide |
| 2,6-dimethylbenzenemagnesium bromide |
| 2,6-Dimethylphenylmagnesium bromide solution |
| 2,5-DIMETHYL-1-(5-METHYL-PYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE |