1-(5-BROMO-2-HYDROXYPHENYL)-3-(DIETHYL&
Modify Date: 2025-08-25 10:42:44
1-(5-BROMO-2-HYDROXYPHENYL)-3-(DIETHYL& structure
|
Common Name | 1-(5-BROMO-2-HYDROXYPHENYL)-3-(DIETHYL& | ||
|---|---|---|---|---|
| CAS Number | 213690-00-7 | Molecular Weight | 298.17600 | |
| Density | 1.361g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C13H16BrNO2 | Melting Point | 73-77ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 189.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(5-bromo-2-hydroxyphenyl)-3-(diethylamino)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Melting Point | 73-77ºC(lit.) |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.17600 |
| Flash Point | 189.3ºC |
| Exact Mass | 297.03600 |
| PSA | 40.54000 |
| LogP | 3.19290 |
| Vapour Pressure | 1.27E-06mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | WGCAWTUPPWTJJF-BQYQJAHWSA-N |
| SMILES | CCN(C=CC(=O)c1cc(Br)ccc1O)CC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD03424558 |