Selcopintide
Modify Date: 2025-08-27 08:54:02
Selcopintide structure
|
Common Name | Selcopintide | ||
|---|---|---|---|---|
| CAS Number | 2130912-34-2 | Molecular Weight | 1384.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C62H105N21O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SelcopintideSelcopintide (Cpne7-DP) consists of a synthetic peptide corresponding to the 10 amino acid residue 344-353 fragment of the hCPNE7 protein. Selcopintide promotes dentin regeneration in dentinal defects of various degrees and that the regenerated hard tissue demonstrates the characteristics of true dentin[1]. |
| Name | Selcopintide |
|---|
| Description | Selcopintide (Cpne7-DP) consists of a synthetic peptide corresponding to the 10 amino acid residue 344-353 fragment of the hCPNE7 protein. Selcopintide promotes dentin regeneration in dentinal defects of various degrees and that the regenerated hard tissue demonstrates the characteristics of true dentin[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Selcopintide (Cpne7-DP) directly penetrates odontoblastic cell[1]. |
| In Vivo | Selcopintide (Cpne7-DP) induces the regeneration of tubular orthodentin in both dentin defect canine models, and promotes dentinal tubule occlusion by inducing peritubular dentin formation[1]. |
| References |
| Molecular Formula | C62H105N21O15 |
|---|---|
| Molecular Weight | 1384.63 |
| InChIKey | OSCUVTZLPKFJMX-CUZNLEPHSA-N |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(CCC(N)=O)C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)O |