Sulfo-Cy5-TCO
Modify Date: 2025-08-26 11:06:04
Sulfo-Cy5-TCO structure
|
Common Name | Sulfo-Cy5-TCO | ||
|---|---|---|---|---|
| CAS Number | 2129525-69-3 | Molecular Weight | 959.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H62N4O12S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-Cy5-TCOSulfo-Cy5-TCO is a click chemistry reagent containing a TCO group. Sulfo-Cy5-TCO is water soluble dye, which is highly reactive with tetrazines and methyltetrazines with the fastest bioconjugation speed[1]. |
| Name | Sulfo-Cy5-TCO |
|---|
| Description | Sulfo-Cy5-TCO is a click chemistry reagent containing a TCO group. Sulfo-Cy5-TCO is water soluble dye, which is highly reactive with tetrazines and methyltetrazines with the fastest bioconjugation speed[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C46H62N4O12S3 |
|---|---|
| Molecular Weight | 959.20 |
| InChIKey | NOAVEHFDKWMOKQ-WAYWQWQTSA-N |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCS(=O)(=O)[O-])c3ccc(S(=O)(=O)O)cc3C2(C)C)N(CCCCCC(=O)NCCCNC(=O)OC2CCC=CCCC2)c2ccc(S(=O)(=O)O)cc21 |