Ipfencarbazone structure
|
Common Name | Ipfencarbazone | ||
|---|---|---|---|---|
| CAS Number | 212201-70-2 | Molecular Weight | 427.23200 | |
| Density | 1.46g/cm3 | Boiling Point | 494.5ºC at 760 mmHg | |
| Molecular Formula | C18H14Cl2F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.8ºC | |
Use of IpfencarbazoneIpfencarbazone is a substance being developed for the control of weeds such as watergrass in rice; herbicide agent. |
| Name | ipfencarbazone |
|---|---|
| Synonym | More Synonyms |
| Description | Ipfencarbazone is a substance being developed for the control of weeds such as watergrass in rice; herbicide agent. |
|---|---|
| Related Catalog |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 494.5ºC at 760 mmHg |
| Molecular Formula | C18H14Cl2F2N4O2 |
| Molecular Weight | 427.23200 |
| Flash Point | 252.8ºC |
| Exact Mass | 426.04600 |
| PSA | 60.13000 |
| LogP | 4.50210 |
| Index of Refraction | 1.626 |
| InChIKey | DHYXNIKICPUXJI-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)n1cnn(-c2ccc(Cl)cc2Cl)c1=O)c1ccc(F)cc1F |
| Storage condition | 2-8℃ |
| 1-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-1,5-dihydro-N-(1-methylethyl)-5-oxo-4H-1,2,4-triazole-4-carboxamide |
| Ipfencarbazone |
| 1-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-5-oxo-N-(propan-2-yl)-1,5-dihydro-4H-1,2,4-triazole-4-carboxamide |
| 1-(2,4-dichlorophenyl)-2’,4’-difluoro-1,5-dihydro-N-isopropyl-5-oxo-4H-1,2,4-triazole-4-carboxanilide |
| UNII-UQ14O0CKS1 |
| 1-(2,4-dichlorophenyl)-N-(2,4-difluorophenyl)-5-oxo-N-propan-2-yl-1,2,4-triazole-4-carboxamide |