3,20-Dioxopregn-4-en-21-yl 4-bromobenzenesulfonate
Modify Date: 2025-08-23 07:52:23
3,20-Dioxopregn-4-en-21-yl 4-bromobenzenesulfonate structure
|
Common Name | 3,20-Dioxopregn-4-en-21-yl 4-bromobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 21170-34-3 | Molecular Weight | 549.51700 | |
| Density | 1.42g/cm3 | Boiling Point | 645.9ºC at 760mmHg | |
| Molecular Formula | C27H33BrO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.4ºC | |
| Name | 3,20-Dioxopregn-4-en-21-yl 4-bromobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 645.9ºC at 760mmHg |
| Molecular Formula | C27H33BrO5S |
| Molecular Weight | 549.51700 |
| Flash Point | 344.4ºC |
| Exact Mass | 548.12300 |
| PSA | 85.89000 |
| LogP | 6.95240 |
| Vapour Pressure | 1.43E-16mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | ZQNARVKYKGBJES-YNHSGCSHSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(C(=O)COS(=O)(=O)c3ccc(Br)cc3)CCC12 |
|
~%
3,20-Dioxopregn... CAS#:21170-34-3 |
| Literature: Dexheimer, Thomas S.; Gediya, Lalji K.; Stephen, Andrew G.; Weidlich, Iwona; Antony, Smitha; Marchand, Christophe; Interthal, Heidrun; Nicklaus, Marc; Fisher, Robert J.; Njar, Vincent C.; Pommier, Yves Journal of Medicinal Chemistry, 2009 , vol. 52, # 22 p. 7122 - 7131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| cholerebic |
| Septocholl |
| septochol |
| deoxycholic |
| droxolan |
| desoxycholic acid |
| CHOLEIC ACID |
| degalol |
| cholorebic |
| pyrochol |
| Deoxycholatic acid |
| Desoxycorticosteron-21-<p-brombenzol-sulfonat> |