1-Methanesulfonyl-4-phenoxy-benzene
Modify Date: 2025-08-25 17:19:23
1-Methanesulfonyl-4-phenoxy-benzene structure
|
Common Name | 1-Methanesulfonyl-4-phenoxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 21134-15-6 | Molecular Weight | 248.29800 | |
| Density | 1.23g/cm3 | Boiling Point | 407.6ºC at 760mmHg | |
| Molecular Formula | C13H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | 1-methylsulfonyl-4-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 407.6ºC at 760mmHg |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.29800 |
| Flash Point | 200.3ºC |
| Exact Mass | 248.05100 |
| PSA | 51.75000 |
| LogP | 3.96320 |
| Vapour Pressure | 1.75E-06mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | XVEKOLSQMFRDKJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2909309090 |
|---|
|
~78%
1-Methanesulfon... CAS#:21134-15-6 |
| Literature: Sinisi, Roberta; Sani, Monica; Candiani, Gabriele; Parente, Rachele; Pecker, Francoise; Bellosta, Stefano; Zanda, Matteo Tetrahedron Letters, 2005 , vol. 46, # 38 p. 6515 - 6518 |
|
~85%
1-Methanesulfon... CAS#:21134-15-6 |
| Literature: Cui, Sun-Liang; Jiang, Zhi-Yong; Wang, Yan-Guang Synlett, 2004 , # 10 p. 1829 - 1831 |
|
~%
1-Methanesulfon... CAS#:21134-15-6 |
| Literature: Arcoria,A. et al. Gazzetta Chimica Italiana, 1961 , vol. 91, p. 223 - 241 |
![1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone structure](https://image.chemsrc.com/caspic/485/83642-22-2.png)
CAS#:83642-22-2![[4-(4-methylsulfonylphenoxy)phenyl]-phenylmethanone structure](https://image.chemsrc.com/caspic/447/83642-23-3.png)
CAS#:83642-23-3| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Methylsulfonyl-diphenylaether |
| 1-methanesulfonyl-4-phenoxy-benzene |
| Benzene,1-(methylsulfonyl)-4-phenoxy |
| 4-Methylsulfon-diphenylether |
| 4-phenoxyphenyl methyl sulfone |
| 1-(4-(methylsulfonyl)phenoxy]benzene |
| p-Phenoxyphenylmethylsulfon |
| GL-1065 |
| 4-methylsulfonyl-diphenyl ether |