4-methoxyphenethylmagnesium chloride
Modify Date: 2025-08-27 12:40:12
4-methoxyphenethylmagnesium chloride structure
|
Common Name | 4-methoxyphenethylmagnesium chloride | ||
|---|---|---|---|---|
| CAS Number | 211115-05-8 | Molecular Weight | 194.94100 | |
| Density | 0.925 g/mL at 25ºC | Boiling Point | 65ºC | |
| Molecular Formula | C9H11ClMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -17ºC | |
| Name | magnesium,1-ethyl-4-methoxybenzene,chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.925 g/mL at 25ºC |
|---|---|
| Boiling Point | 65ºC |
| Molecular Formula | C9H11ClMgO |
| Molecular Weight | 194.94100 |
| Flash Point | -17ºC |
| Exact Mass | 194.03500 |
| PSA | 9.23000 |
| LogP | 2.89480 |
| Appearance of Characters | Liquid | Yellow to brown |
| InChIKey | YXPRYYDYOYHYLU-UHFFFAOYSA-M |
| SMILES | [CH2-]Cc1ccc(OC)cc1.[Cl-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F,C |
|---|---|
| Risk Phrases | 11-14-19-22-34 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| 4-Methoxyphenethylmagnesium chloride 0.5 M in Tetrahydrofuran |
| MFCD01319915 |
| 4-Methoxyphenethylmagnesium chloride solution |