3,5-Dichlorophenyl-4-nitrophenyl ether
Modify Date: 2025-08-26 11:43:24
3,5-Dichlorophenyl-4-nitrophenyl ether structure
|
Common Name | 3,5-Dichlorophenyl-4-nitrophenyl ether | ||
|---|---|---|---|---|
| CAS Number | 21105-77-1 | Molecular Weight | 284.09500 | |
| Density | 1.451g/cm3 | Boiling Point | 378.5ºC at 760 mmHg | |
| Molecular Formula | C12H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 3,5-Dichlorophenyl-4-nitrophenyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 378.5ºC at 760 mmHg |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.09500 |
| Flash Point | 182.7ºC |
| Exact Mass | 282.98000 |
| PSA | 55.05000 |
| LogP | 5.21710 |
| Vapour Pressure | 1.36E-05mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | KWZIXOIDCOTWKE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(Cl)cc(Cl)c2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-dichloro-4-methoxy-butan-2-one |
| 1,3-dichloro-5-(4-nitrophenoxy)-benzene |
| ETHYL 4-[4-[2-(4-METHOXYPHENYL)ACETYL]-3-METHYL-PIPERAZINE-1-CARBONYL]-2-METHYL-6-PROPYL-PYRIMIDINE-5-CARBOXYLATE |