1,1,1,3,5,6-HEXACHLOROOCTAFLUOROHEXANE structure
|
Common Name | 1,1,1,3,5,6-HEXACHLOROOCTAFLUOROHEXANE | ||
|---|---|---|---|---|
| CAS Number | 2106-32-3 | Molecular Weight | 436.76900 | |
| Density | 1.873 | Boiling Point | 130ºC 50mm | |
| Molecular Formula | C6Cl6F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.8ºC | |
| Name | 1,1,1,3,5,6-Hexachloro-2,2,3,4,4,5,6,6-octafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.873 |
|---|---|
| Boiling Point | 130ºC 50mm |
| Molecular Formula | C6Cl6F8 |
| Molecular Weight | 436.76900 |
| Flash Point | 170.8ºC |
| Exact Mass | 433.80000 |
| LogP | 6.26800 |
| Vapour Pressure | 0.000804mmHg at 25°C |
| Index of Refraction | 1.421 |
| InChIKey | ZUBPFQXYAINABF-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(Cl)(Cl)Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903799090 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1,3,5,6-hexakis(chloranyl)-2,2,3,4,4,5,6,6-octakis(fluoranyl)hexane |
| 1,1,1,3,5,6-Hexachlorooctafluorohexane |
| PC4524 |