5-methyl-5-naphthalen-2-yl-oxolan-2-one structure
|
Common Name | 5-methyl-5-naphthalen-2-yl-oxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 21053-55-4 | Molecular Weight | 226.27000 | |
| Density | 1.172g/cm3 | Boiling Point | 423.2ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 5-methyl-5-naphthalen-2-yloxolan-2-one |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 178.8ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.39200 |
| Vapour Pressure | 2.28E-07mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | RPEAXJCKWAGUGS-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc3ccccc3c2)CCC(=O)O1 |
|
~%
5-methyl-5-naph... CAS#:21053-55-4 |
| Literature: Johnson; Johnson; Petersen Journal of the American Chemical Society, 1945 , vol. 67, p. 1360,1364 |
|
~%
5-methyl-5-naph... CAS#:21053-55-4 |
| Literature: Robinson; Slater Journal of the Chemical Society, 1941 , p. 376,380 |
|
~%
5-methyl-5-naph... CAS#:21053-55-4 |
| Literature: Robinson; Slater Journal of the Chemical Society, 1941 , p. 376,380 |