Z-VEID-FMK structure
|
Common Name | Z-VEID-FMK | ||
|---|---|---|---|---|
| CAS Number | 210344-96-0 | Molecular Weight | 652.70800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H45FN4O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-VEID-FMKZ-VEID-FMK is a selective inhibitor of caspase-6. Z-VEID-FMK can be used for the research of tumor[1]. |
| Name | methyl 5-[[1-[(5-fluoro-1-methoxy-1,4-dioxopentan-3-yl)amino]-3-methyl-1-oxopentan-2-yl]amino]-4-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-VEID-FMK is a selective inhibitor of caspase-6. Z-VEID-FMK can be used for the research of tumor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C31H45FN4O10 |
|---|---|
| Molecular Weight | 652.70800 |
| Exact Mass | 652.31200 |
| PSA | 209.26000 |
| LogP | 4.21810 |
| InChIKey | YPIHFMWAHMPACV-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)OC)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C)C(=O)NC(CC(=O)OC)C(=O)CF |
| Z-Val-Glu(OMe)-Ile-Asp(OMe)-Fluoromethylketone |
| FK015 |
| Z-Val-Glu(OMe)-Ile-Asp(OMe)-FMK |
| Z-VE(OMe)ID(OMe)-FMK |