JAK-IN-5
Modify Date: 2025-08-27 10:40:01
JAK-IN-5 structure
|
Common Name | JAK-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2096999-92-5 | Molecular Weight | 474.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31FN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JAK-IN-5JAK inhibitor 1 is an inhibitor of JAK extracted from patent US20170121327A1, compound example 283. |
| Name | JAK inhibitor 1 |
|---|
| Description | JAK inhibitor 1 is an inhibitor of JAK extracted from patent US20170121327A1, compound example 283. |
|---|---|
| Related Catalog | |
| Target |
JAK[1] |
| References |
| Molecular Formula | C27H31FN6O |
|---|---|
| Molecular Weight | 474.57 |
| InChIKey | YEGFDJOAFMPJSE-UHFFFAOYSA-N |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CN(C3CCN(C)CC3)CC4)n[nH]c2c1 |