2-(2,4-Dichlorobenzyl)thioadenosine structure
|
Common Name | 2-(2,4-Dichlorobenzyl)thioadenosine | ||
|---|---|---|---|---|
| CAS Number | 2095417-37-9 | Molecular Weight | 458.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17Cl2N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(2,4-Dichlorobenzyl)thioadenosine2-(2,4-Dichlorobenzyl)thioadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 2-(2,4-Dichlorobenzyl)thioadenosine |
|---|
| Description | 2-(2,4-Dichlorobenzyl)thioadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H17Cl2N5O4S |
|---|---|
| Molecular Weight | 458.32 |
| InChIKey | GHSJUTIELLTXHS-XNIJJKJLSA-N |
| SMILES | Nc1nc(SCc2ccc(Cl)cc2Cl)nc2c1ncn2C1OC(CO)C(O)C1O |