2-phenylbut-3-yn-2-yl N-cyclohexylcarbamate
Modify Date: 2025-09-19 19:40:21
2-phenylbut-3-yn-2-yl N-cyclohexylcarbamate structure
|
Common Name | 2-phenylbut-3-yn-2-yl N-cyclohexylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 20921-41-9 | Molecular Weight | 271.35400 | |
| Density | 1.09g/cm3 | Boiling Point | 398.9ºC at 760 mmHg | |
| Molecular Formula | C17H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | 2-phenylbut-3-yn-2-yl N-cyclohexylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760 mmHg |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.35400 |
| Flash Point | 195ºC |
| Exact Mass | 271.15700 |
| PSA | 41.82000 |
| LogP | 3.79830 |
| Vapour Pressure | 1.43E-06mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | WLZGMHXRIVMSEG-UHFFFAOYSA-N |
| SMILES | C#CC(C)(OC(=O)NC1CCCCC1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-phenylbut-3-y... CAS#:20921-41-9 |
| Literature: Dillard,R.D. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 6 p. 1155 - 1158 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclohexanecarbamic acid,1-methyl-1-phenyl-2-propynyl ester |
| 1-Methyl-1-phenyl-2-propynyl-N-cyclohexylcarbamate |
| 2-phenylbut-3-yn-2-yl cyclohexylcarbamate |
| 1-Methyl-1-phenyl-2-propynyl cyclohexanecarbamate |