2-methylbut-3-yn-2-yl N-(3-chlorophenyl)carbamate
Modify Date: 2025-08-26 11:55:01
2-methylbut-3-yn-2-yl N-(3-chlorophenyl)carbamate structure
|
Common Name | 2-methylbut-3-yn-2-yl N-(3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 32496-78-9 | Molecular Weight | 237.68200 | |
| Density | 1.246g/cm3 | Boiling Point | 281.9ºC at 760 mmHg | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.3ºC | |
| Name | 2-methylbut-3-yn-2-yl N-(3-chlorophenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 281.9ºC at 760 mmHg |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.68200 |
| Flash Point | 124.3ºC |
| Exact Mass | 237.05600 |
| PSA | 38.33000 |
| LogP | 3.37330 |
| Index of Refraction | 1.58 |
| InChIKey | KTBHKZPSGVSLPP-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)OC(=O)Nc1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
2-methylbut-3-y... CAS#:32496-78-9 |
| Literature: Mesplie, Yolande; Bergon, Michel; Calmon, Jean-Pierre Journal of Heterocyclic Chemistry, 1984 , vol. 21, p. 985 - 993 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3-Chlor-phenyl)-carbamidsaeure-(1,1-dimethyl-prop-2-inylester) |
| chloro-3 carbanilate de dimethyl-1,1 propyne-2 yle |
| (1,1-dimethylprop-2-ynyloxy)-N-(3-chlorophenyl)carboxamide |
| (3-chloro-phenyl)-carbamic acid-(1,1-dimethyl-prop-2-ynyl ester) |
| 3-(3-chloro-phenylcarbamoyloxy)-3-methyl-but-1-yne |