L-Lysine thioctate structure
|
Common Name | L-Lysine thioctate | ||
|---|---|---|---|---|
| CAS Number | 20902-53-8 | Molecular Weight | 352.51 | |
| Density | N/A | Boiling Point | 362.5ºC at 760mmHg | |
| Molecular Formula | C14H28N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
Use of L-Lysine thioctateL-Lysine thioctate is a substrate of lipoamidase[1]. |
| Name | (2S)-2,6-diaminohexanoic acid: 5-(dithiolan-3-yl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | L-Lysine thioctate is a substrate of lipoamidase[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 362.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H28N2O4S2 |
| Molecular Weight | 352.51 |
| Flash Point | 173ºC |
| Exact Mass | 570.47600 |
| PSA | 92.42000 |
| LogP | 8.90360 |
| Vapour Pressure | 3.07E-06mmHg at 25°C |
| InChIKey | WCHWQPTUXDMALZ-ZSCHJXSPSA-N |
| SMILES | NCCCCC(N)C(=O)O.O=C(O)CCCCC1CCSS1 |
| lipoyllysine |