AOH1996 structure
|
Common Name | AOH1996 | ||
|---|---|---|---|---|
| CAS Number | 2089314-64-5 | Molecular Weight | 426.46 | |
| Density | 1.269±0.06 g/cm3(Predicted) | Boiling Point | 703.9±50.0 °C(Predicted) | |
| Molecular Formula | C26H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AOH1996AOH1996 is an orally active ligand of replisome component PCNA (Proliferating cell nuclear antigen), targeting to transcription-replication conflict (TRC). AOH1996 stabilizes the interaction of PCNA and RNA polymerase II, causing proteasome-dependent degradation of rpb1 and lethal DNA damages. AOH1996 also interferes the interaction of PCNA and its binding proteins, leading to DNA replication stress and inducing apoptosis. AOH1996 exerts synergistic effect with DNA damage agents, to inhibit tumor cells[1][2]. |
| Name | aoh1996 |
|---|
| Description | AOH1996 is an orally active ligand of replisome component PCNA (Proliferating cell nuclear antigen), targeting to transcription-replication conflict (TRC). AOH1996 stabilizes the interaction of PCNA and RNA polymerase II, causing proteasome-dependent degradation of rpb1 and lethal DNA damages. AOH1996 also interferes the interaction of PCNA and its binding proteins, leading to DNA replication stress and inducing apoptosis. AOH1996 exerts synergistic effect with DNA damage agents, to inhibit tumor cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PCNA, Proliferating cell nuclear antigen[1][2] |
| References |
| Density | 1.269±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 703.9±50.0 °C(Predicted) |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.46 |
| InChIKey | HDMONPHKMIZXDH-UHFFFAOYSA-N |
| SMILES | COc1cccc(Oc2ccccc2NC(=O)CNC(=O)c2cccc3ccccc23)c1 |