Bodipy 8-Chloromethane structure
|
Common Name | Bodipy 8-Chloromethane | ||
|---|---|---|---|---|
| CAS Number | 208462-25-3 | Molecular Weight | 296.55100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16BClF2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bodipy 8-ChloromethaneBODIPY-8-chloromethane is a fluorophore. BODIPY-8-chloromethane can be used as as a fluorescent probe[1]. |
| Name | Bodipy 8-Chloromethane |
|---|
| Description | BODIPY-8-chloromethane is a fluorophore. BODIPY-8-chloromethane can be used as as a fluorescent probe[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H16BClF2N2 |
|---|---|
| Molecular Weight | 296.55100 |
| Exact Mass | 296.10600 |
| PSA | 13.32000 |
| LogP | 3.04540 |
| InChIKey | PFXASTXHAMZMNO-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)=[N+]2C1=C(CCl)c1c(C)cc(C)n1[B-]2(F)F |