Strictosidine
Modify Date: 2025-08-27 11:57:39
Strictosidine structure
|
Common Name | Strictosidine | ||
|---|---|---|---|---|
| CAS Number | 20824-29-7 | Molecular Weight | 530.56700 | |
| Density | 1.443g/cm3 | Boiling Point | 763.008°C at 760 mmHg | |
| Molecular Formula | C27H34N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 415.252°C | |
Use of StrictosidineStrictosidine, the central intermediate in monoterpene indole alkaloid (MIA) biosynthesis, undergoes a series of reactions to produce over 3,000 known MIAs such as Vincristine, Quinine (HY-D0143), and Strychnine[1]. |
| Name | 3α(S)-strictosidine |
|---|---|
| Synonym | More Synonyms |
| Description | Strictosidine, the central intermediate in monoterpene indole alkaloid (MIA) biosynthesis, undergoes a series of reactions to produce over 3,000 known MIAs such as Vincristine, Quinine (HY-D0143), and Strychnine[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 763.008°C at 760 mmHg |
| Molecular Formula | C27H34N2O9 |
| Molecular Weight | 530.56700 |
| Flash Point | 415.252°C |
| Exact Mass | 530.22600 |
| PSA | 162.73000 |
| LogP | 0.72170 |
| InChIKey | XBAMJZTXGWPTRM-NTXHKPOFSA-N |
| SMILES | C=CC1C(OC2OC(CO)C(O)C(O)C2O)OC=C(C(=O)OC)C1CC1NCCc2c1[nH]c1ccccc21 |
| 3alpha(S)-strictosidine |
| Strictosidine |
| (5S)-5-carboxystrictosidine |