4-[4-(trifluoromethyl)phenyl]-3-thiosemicarbazide structure
|
Common Name | 4-[4-(trifluoromethyl)phenyl]-3-thiosemicarbazide | ||
|---|---|---|---|---|
| CAS Number | 206761-90-2 | Molecular Weight | 235.22900 | |
| Density | 1.471g/cm3 | Boiling Point | 290.4ºC at 760mmHg | |
| Molecular Formula | C8H8F3N3S | Melting Point | 171-172°C (dec.) | |
| MSDS | N/A | Flash Point | 129.4ºC | |
| Name | 1-amino-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Boiling Point | 290.4ºC at 760mmHg |
| Melting Point | 171-172°C (dec.) |
| Molecular Formula | C8H8F3N3S |
| Molecular Weight | 235.22900 |
| Flash Point | 129.4ºC |
| Exact Mass | 235.03900 |
| PSA | 82.17000 |
| LogP | 3.02970 |
| Vapour Pressure | 0.00208mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | NWPGZYRPTJGBPI-UHFFFAOYSA-N |
| SMILES | NNC(=S)Nc1ccc(C(F)(F)F)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 2811 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2930909090 |
|
~88%
4-[4-(trifluoro... CAS#:206761-90-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 53, # 8 p. 3048 - 3064 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00041301 |
| 4-[4-(Trifluoromethyl)phenyl]-3-thiosemicarbazide |