(5-Bromo-2-pyridinyl)(phenyl)methanone
Modify Date: 2025-09-12 17:24:48
(5-Bromo-2-pyridinyl)(phenyl)methanone structure
|
Common Name | (5-Bromo-2-pyridinyl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 206357-52-0 | Molecular Weight | 262.102 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 356.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H8BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7±22.3 °C | |
| Name | (5-bromopyridin-2-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 356.9±22.0 °C at 760 mmHg |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.102 |
| Flash Point | 169.7±22.3 °C |
| Exact Mass | 260.978912 |
| PSA | 29.96000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | LTXZWEQLVKTQRI-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Br)cn1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (5-Bromopyridin-2-yl)(phenyl)methanone |
| (5-Bromo-2-pyridinyl)(phenyl)methanone |
| Methanone, (5-bromo-2-pyridinyl)phenyl- |
| (5-Bromo-pyridin-2-yl)-phenyl-methanone |
| (5-bromo-2-pyridinyl)-phenylmethanone |