TERT-BUTYL 4-(BENZYLAMINO)PIPERIDINE-1-CARBOXYLATE structure
|
Common Name | TERT-BUTYL 4-(BENZYLAMINO)PIPERIDINE-1-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 206273-87-2 | Molecular Weight | 290.401 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 398.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C17H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6±25.9 °C | |
| Name | tert-butyl 4-(benzylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.1±35.0 °C at 760 mmHg |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.401 |
| Flash Point | 194.6±25.9 °C |
| Exact Mass | 290.199432 |
| PSA | 41.57000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | IUJZIXJMTQNFOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCc2ccccc2)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
|
~99%
TERT-BUTYL 4-(B... CAS#:206273-87-2 |
| Literature: Pryde, David C.; Corless, Martin; Fenwick, David R.; Mason, Helen J.; Stammen, Blanda C.; Stephenson, Peter T.; Ellis, David; Bachelor, David; Gordon, David; Barber, Christopher G.; Wood, Anthony; Middleton, Donald S.; Blakemore, David C.; Parsons, Gemma C.; Eastwood, Rachel; Platts, Michelle Y.; Statham, Keith; Paradowski, Kerry A.; Burt, Catherine; Klute, Wolfgang Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 4 p. 1084 - 1088 |
|
~%
TERT-BUTYL 4-(B... CAS#:206273-87-2 |
| Literature: US2006/19985 A1, ; Page/Page column 20 ; |
|
~10%
TERT-BUTYL 4-(B... CAS#:206273-87-2 |
| Literature: Bridger, Gary; Kaller, Al; Harwig, Curtis; Skerlj, Renato; Bogucki, David; Wilson, Trevor R.; Crawford, Jason; McEachern, Ernest J.; Atsma, Bem; Nan, Siqiao; Zhou, Yuanxi; Schols, Dominique; Smith, Christopher D.; Di Fluri, Maria R. Patent: US2004/19058 A1, 2004 ; US 20040019058 A1 |
|
~%
TERT-BUTYL 4-(B... CAS#:206273-87-2 |
| Literature: US2004/82612 A1, ; US 20040082612 A1 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 4-(benzylamino)piperidine-1-carboxylate |
| 4-N-benzylamino-1-tert-butoxycarbonyl piperidine |
| 2-Methyl-2-propanyl 4-(benzylamino)-1-piperidinecarboxylate |
| 1-BOC-4-BENZYLAMINOPIPERIDINE |
| 4-benzylamino-piperidine-1-carboxylic acid tert-butyl ester |
| 1-Piperidinecarboxylic acid, 4-[(phenylmethyl)amino]-, 1,1-dimethylethyl ester |