perazine sulfoxide
Modify Date: 2025-11-27 21:52:16
perazine sulfoxide structure
|
Common Name | perazine sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 20627-44-5 | Molecular Weight | 355.49700 | |
| Density | 1.3g/cm3 | Boiling Point | 545.8ºC at 760 mmHg | |
| Molecular Formula | C20H25N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.9ºC | |
| Name | 10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine 5-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 545.8ºC at 760 mmHg |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.49700 |
| Flash Point | 283.9ºC |
| Exact Mass | 355.17200 |
| PSA | 46.00000 |
| LogP | 3.74880 |
| Vapour Pressure | 5.72E-12mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | QGGFCTLXKUUQAT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCCN2c3ccccc3S(=O)c3ccccc32)CC1 |
| Storage condition | -20°C |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-(3-(4-Methyl-1-piperazinyl)propyl)-10H-phenothiazine,5-oxide |
| Perazine Sulphoxide |
| perazine 5-sulphoxide |
| Perazine-5-sulfoxide |
| 10-[3-(4-methyl-piperazin-1-yl)-propyl]-10H-phenothiazine 5-oxide |
| Perazinsulfoxid |
| Perazine sulfoxide |