trifluoperazine sulfoxide
Modify Date: 2025-08-26 10:04:09
trifluoperazine sulfoxide structure
|
Common Name | trifluoperazine sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 1549-88-8 | Molecular Weight | 423.49500 | |
| Density | 1.39g/cm3 | Boiling Point | 553ºC at 760mmHg | |
| Molecular Formula | C21H24F3N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.2ºC | |
| Name | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)phenothiazine 5-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 553ºC at 760mmHg |
| Molecular Formula | C21H24F3N3OS |
| Molecular Weight | 423.49500 |
| Flash Point | 288.2ºC |
| Exact Mass | 423.15900 |
| PSA | 46.00000 |
| LogP | 4.76760 |
| Vapour Pressure | 2.84E-12mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | UCTLPXYMIYHZST-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCCN2c3ccccc3S(=O)c3ccc(C(F)(F)F)cc32)CC1 |
|
~98%
trifluoperazine... CAS#:1549-88-8 |
| Literature: Bosch, Eric; Kochi, Jay K. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 8 p. 1057 - 1064 |
|
~%
trifluoperazine... CAS#:1549-88-8 |
| Literature: Wisniewska, Joanna; Rzesnicki, Pawel; Topolski, Adrian Transition Metal Chemistry, 2011 , vol. 36, # 7 p. 767 - 774 |
| trifluoroperazine sulfoxide |
| triftazin S-oxide |
| 10-[3-(4-Methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-10H-phenothiazine 5-oxide |
| Trifluperazine sulfoxide |
| 10-[3-(4-Methyl-piperazino)-propyl]-2-trifluormethyl-phenothiazin-5-oxid |
| 10-[3-(4-methyl-piperazino)-propyl]-2-trifluoromethyl-phenothiazine-5-oxide |
| Trifluoperazin-sulfoxid |
| 10-[3-(4-methyl-piperazin-1-yl)-propyl]-2-trifluoromethyl-10H-phenothiazine 5-oxide |
| Trifluoperazine sulfoxide |