3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid,hydrate
Modify Date: 2025-08-25 19:12:08
3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid,hydrate structure
|
Common Name | 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid,hydrate | ||
|---|---|---|---|---|
| CAS Number | 205680-84-8 | Molecular Weight | 255.18100 | |
| Density | N/A | Boiling Point | 480.2ºC at 760mmHg | |
| Molecular Formula | C10H9NO7 | Melting Point | 214-216(dec.)ºC | |
| MSDS | N/A | Flash Point | 211.2ºC | |
| Name | 3-(1,3-dioxopropan-2-yl)-4-nitrobenzoic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 480.2ºC at 760mmHg |
|---|---|
| Melting Point | 214-216(dec.)ºC |
| Molecular Formula | C10H9NO7 |
| Molecular Weight | 255.18100 |
| Flash Point | 211.2ºC |
| Exact Mass | 255.03800 |
| PSA | 126.49000 |
| LogP | 1.23330 |
| Vapour Pressure | 3.41E-13mmHg at 25°C |
| InChIKey | SWNCDLAMOWGSKH-UHFFFAOYSA-N |
| SMILES | O.O=CC(C=O)c1cc(C(=O)O)ccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| c-5747 |