Intermediate of Rolapitant
Modify Date: 2025-08-25 17:23:07
Intermediate of Rolapitant structure
|
Common Name | Intermediate of Rolapitant | ||
|---|---|---|---|---|
| CAS Number | 205654-80-4 | Molecular Weight | 373.401 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 591.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6±30.1 °C | |
| Name | Benzyl (2R,4S)-5-oxo-2,4-diphenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 591.6±50.0 °C at 760 mmHg |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.401 |
| Flash Point | 311.6±30.1 °C |
| Exact Mass | 373.131409 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | VUHAXUDTXAGDSL-LEWJYISDSA-N |
| SMILES | O=C1OC(c2ccccc2)N(C(=O)OCc2ccccc2)C1c1ccccc1 |
| Benzyl (2R,4S)-5-oxo-2,4-diphenyl-1,3-oxazolidine-3-carboxylate |
| 3-Oxazolidinecarboxylic acid, 5-oxo-2,4-diphenyl-, phenylmethyl ester, (2R,4S)- |