Rauvovertine B structure
|
Common Name | Rauvovertine B | ||
|---|---|---|---|---|
| CAS Number | 2055073-72-6 | Molecular Weight | 326.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rauvovertine BRauvovertine B is a hexacyclic monoterpenoid indole alkaloid that can be found in Rauvolfia verticillata[1]. |
| Name | Rauvovertine B |
|---|
| Description | Rauvovertine B is a hexacyclic monoterpenoid indole alkaloid that can be found in Rauvolfia verticillata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H22N2O3 |
|---|---|
| Molecular Weight | 326.39 |
| InChIKey | YQFGLJJOGMUWSM-QNSANRQCSA-N |
| SMILES | CC1C2COC(O)C3C2CC2c4[nH]c5ccc(O)cc5c4CC3N21 |
| Storage condition | 2-8℃ |