4-methyl-3-sulfamoyl-benzoate structure
|
Common Name | 4-methyl-3-sulfamoyl-benzoate | ||
|---|---|---|---|---|
| CAS Number | 20532-05-2 | Molecular Weight | 215.22600 | |
| Density | 1.462g/cm3 | Boiling Point | 487ºC at 760 mmHg | |
| Molecular Formula | C8H9NO4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 248.3ºC | |
| Name | 4-methyl-3-sulfamoylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 487ºC at 760 mmHg |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.22600 |
| Flash Point | 248.3ºC |
| Exact Mass | 215.02500 |
| PSA | 105.84000 |
| LogP | 2.12170 |
| Vapour Pressure | 2.67E-10mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | USYIWRQZOYSBNN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1S(N)(=O)=O |
| Hazard Codes | Xn |
|---|
|
~87%
4-methyl-3-sulf... CAS#:20532-05-2 |
| Literature: AVEXA LIMITED Patent: WO2007/124546 A1, 2007 ; Location in patent: Page/Page column 34 ; |
|
~%
4-methyl-3-sulf... CAS#:20532-05-2 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4302241 A1, 1981 ; |
| 4-methyl-3-sulfamoyl-benzoic acid |
| 4-Methyl-3-sulfamoyl-benzoesaeure |
| 2-Methyl-5-carboxy-benzolsulfonsaeureamid |