Cethromycin structure
|
Common Name | Cethromycin | ||
|---|---|---|---|---|
| CAS Number | 205110-48-1 | Molecular Weight | 765.93 | |
| Density | 1.22g/cm3 | Boiling Point | 927.1ºC at 760mmHg | |
| Molecular Formula | C42H59N3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 514.5ºC | |
Use of CethromycinCethromycin (ABT-773, Abbott-195773, A-195773) is a ketolide antibiotic[1]. |
| Name | (1R,2R,4R,6R,7R,8R,10R,13R,14S)-7-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-13-ethyl-2,4,6,8,10,14-hexamethyl-6-[(E)-3-quinolin-3-ylprop-2-enoxy]-12,15-dioxa-17-azabicyclo[12.3.0]heptadecane-3,9,11,16-tetrone |
|---|---|
| Synonym | More Synonyms |
| Description | Cethromycin (ABT-773, Abbott-195773, A-195773) is a ketolide antibiotic[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 927.1ºC at 760mmHg |
| Molecular Formula | C42H59N3O10 |
| Molecular Weight | 765.93 |
| Flash Point | 514.5ºC |
| Exact Mass | 765.42000 |
| PSA | 162.82000 |
| LogP | 5.43850 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | PENDGIOBPJLVBT-WNGDBVLYSA-N |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(OC2OC(C)CC(N(C)C)C2O)C(C)(OCC=Cc2cnc3ccccc3c2)CC(C)C(=O)C(C)C2NC(=O)OC12C |
| ABT 773 |
| Restanza |
| Cethromycin |