3,3'-dichlorobiphenyl structure
|
Common Name | 3,3'-dichlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 2050-67-1 | Molecular Weight | 223.09800 | |
| Density | 1.249g/cm3 | Boiling Point | 324.7ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2 | Melting Point | 29℃ | |
| MSDS | N/A | Flash Point | 150.5ºC | |
| Name | 3,3'-dichlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 324.7ºC at 760 mmHg |
| Melting Point | 29℃ |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.09800 |
| Flash Point | 150.5ºC |
| Exact Mass | 222.00000 |
| LogP | 4.66040 |
| Vapour Pressure | 0.000456mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | KTXUOWUHFLBZPW-UHFFFAOYSA-N |
| SMILES | Clc1cccc(-c2cccc(Cl)c2)c1 |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 3,3'-Dichlorodiphenyl |
| 3,3'-dichloro-1,1'-biphenyl |
| Biphenyl,3,3'-dichloro |
| 1,1'-BIPHENYL,3,3'-DICHLORO |
| PCB 11 |
| 3,3'-Dichlorbiphenyl |
| m,m'-Dichlorobiphenyl |
| 3,3'-dichloro-biphenyl |
| BZ NO 11 |
| PCB NO 11 |