2,3,4,5,6-pentachloro-N-methylaniline structure
|
Common Name | 2,3,4,5,6-pentachloro-N-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 2040-46-2 | Molecular Weight | 279.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4Cl5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,4,5,6-pentachloro-N-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4Cl5N |
|---|---|
| Molecular Weight | 279.37800 |
| Exact Mass | 276.87900 |
| PSA | 12.03000 |
| LogP | 5.06830 |
| InChIKey | DAOFIINVTHKDOR-UHFFFAOYSA-N |
| SMILES | CNc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2921420090 |
|---|
|
~%
2,3,4,5,6-penta... CAS#:2040-46-2 |
| Literature: Rocklin Journal of Organic Chemistry, 1956 , vol. 21, p. 1478 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,2,3,4,5,6-pentachloro-N-methyl |
| 2,3,4,5,6-Pentachlor-N-methyl-anilin |
| N-methyl-2,3,4,5,6-pentachloroaniline |
| N-Methyl-pentachlor-anilin |
| Pentachlor-N-methyl-anilin |
| 2,3,4,5,6-pentachloro-N-methyl-aniline |