2,3,4,5,6-PENTACHLORO-1-PYRIDINIUMOLATE
Modify Date: 2025-08-25 18:34:11
2,3,4,5,6-PENTACHLORO-1-PYRIDINIUMOLATE structure
|
Common Name | 2,3,4,5,6-PENTACHLORO-1-PYRIDINIUMOLATE | ||
|---|---|---|---|---|
| CAS Number | 17573-93-2 | Molecular Weight | 267.32500 | |
| Density | 1.92g/cm3 | Boiling Point | 434.1ºC at 760mmHg | |
| Molecular Formula | C5Cl5NO | Melting Point | 179ºC | |
| MSDS | N/A | Flash Point | 216.3ºC | |
| Name | 2,3,4,5,6-pentachloro-1-oxidopyridin-1-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Boiling Point | 434.1ºC at 760mmHg |
| Melting Point | 179ºC |
| Molecular Formula | C5Cl5NO |
| Molecular Weight | 267.32500 |
| Flash Point | 216.3ºC |
| Exact Mass | 264.84200 |
| PSA | 25.46000 |
| LogP | 4.38210 |
| Vapour Pressure | 2.48E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | BBMHWFCIWRBYFW-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
|
~25%
2,3,4,5,6-PENTA... CAS#:17573-93-2 |
| Literature: Zhu, Xizhen; Kreutter, Kevin D.; Hu, Huaping; Player, Mark R.; Gaul, Micheal D. Tetrahedron Letters, 2008 , vol. 49, # 5 p. 832 - 834 |
CAS#:71602-56-7
CAS#:71602-52-3| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| pentachloropyridine N-oxide |
| 2.3.4.5.6-Pentachlorpyridin-1-oxid |
| Pentachlor-pyridin-1-oxid |
| Pentachloropyridine oxide |
| pentachloropyridine 1-oxide |
| Pyridine,pentachloro-,1-oxide |
| pentachloropyridin-1-ium-1-olate |
| 2,3,4,5,6-pentachloro-1-pyridiniumolate |
| Pentachloropyridin-N-oxid |
| Pentachlorpyridin-N-oxid |