2-Amino-3-chloro-5-nitrobenzonitrile structure
|
Common Name | 2-Amino-3-chloro-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 20352-84-5 | Molecular Weight | 197.579 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 353.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClN3O2 | Melting Point | 183-187 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 167.5±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-3-chloro-5-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.4±42.0 °C at 760 mmHg |
| Melting Point | 183-187 °C(lit.) |
| Molecular Formula | C7H4ClN3O2 |
| Molecular Weight | 197.579 |
| Flash Point | 167.5±27.9 °C |
| Exact Mass | 196.999207 |
| PSA | 95.63000 |
| LogP | 2.81 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | XVYNBLCPQVDRCH-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])cc(Cl)c1N |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H312-H317-H319-H332 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
|
~%
2-Amino-3-chlor... CAS#:20352-84-5 |
| Literature: Journal of the Indian Chemical Society, , vol. 73, # 11 p. 629 - 630 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-3-chlor-5-nitro-benzonitril |
| 2-AMINO-3-CHLORO-5-NITROBENZONTRILE |
| 2-CYANO-6-CHLORO-4-NITROANILINE |
| 1-amino-2-cyano-4-nitro-6-chlorobenzene |
| 2-amino 3-chloro 5-nitrobenzonitrile |
| Benzonitrile,2-amino-3-chloro-5-nitro |
| 2-chloro-6-cyano-4-nitroaniline |
| 2-Chloro-4-nitro-6-cyanoaniline |
| 6-CHLORO-2-CYANO-4-NITROANILINE |
| 2-Amino-3-chloro-5-nitrobenzonitrile |
| EINECS 243-760-0 |
| MFCD00126957 |
| 2-amino-3-chloro-5-nitro-benzonitril |
| Benzonitrile, 2-amino-3-chloro-5-nitro- |
| 2-CYANO-4-NITRO-6-CHLORO ANILINE |