isogermafurenolide
Modify Date: 2025-09-17 18:04:52
isogermafurenolide structure
|
Common Name | isogermafurenolide | ||
|---|---|---|---|---|
| CAS Number | 20267-89-4 | Molecular Weight | 232.32 | |
| Density | 1.02±0.1 g/cm3(Predicted) | Boiling Point | 357.6±42.0 °C(Predicted) | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of isogermafurenolideIsogermafurenolide is a cytotoxic Terpenoids from the Wood of Vepris punctata from the Madagascar Rainforest[1]. |
| Name | isogermafurenolide |
|---|
| Description | Isogermafurenolide is a cytotoxic Terpenoids from the Wood of Vepris punctata from the Madagascar Rainforest[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.02±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 357.6±42.0 °C(Predicted) |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| InChIKey | IEOHWPUTLCTSCQ-UHFFFAOYSA-N |
| SMILES | C=CC1(C)CC2OC(=O)C(C)=C2CC1C(=C)C |