L-Glutamic acid-13C5 hydrate salt structure
|
Common Name | L-Glutamic acid-13C5 hydrate salt | ||
|---|---|---|---|---|
| CAS Number | 202114-62-3 | Molecular Weight | 193.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | 13C5H11NNaO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Glutamic acid-13C5 hydrate saltL-Glutamic acid-13C5 (hydrate salt) is the 13C labeled L-Glutamic acid hydrate salt[1]. |
| Name | L-Glutamic acid-13C5 hydrate salt |
|---|
| Description | L-Glutamic acid-13C5 (hydrate salt) is the 13C labeled L-Glutamic acid hydrate salt[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | 13C5H11NNaO5 |
|---|---|
| Molecular Weight | 193.10 |
| InChIKey | GJBHGUUFMNITCI-SUAQCYARSA-M |
| SMILES | NC(CCC(=O)O)C(=O)[O-].O.[Na+] |