methyl 4-(aminocarbonyl)-2-nitrobenzoate
Modify Date: 2022-09-30 17:57:31
methyl 4-(aminocarbonyl)-2-nitrobenzoate structure
|
Common Name | methyl 4-(aminocarbonyl)-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 20132-75-6 | Molecular Weight | 224.17000 | |
| Density | 1.419g/cm3 | Boiling Point | 351.3ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.3ºC | |
| Name | Methyl 4-carbamoyl-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 351.3ºC at 760 mmHg |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.17000 |
| Flash Point | 166.3ºC |
| Exact Mass | 224.04300 |
| PSA | 116.20000 |
| LogP | 1.88770 |
| Vapour Pressure | 4.13E-05mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | OYZKIZQJLPADLO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(N)=O)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Nitro-2-methoxycarbonyl-5-carbamoyl-benzol |
| EINECS 243-537-8 |
| Methyl 4-(aminocarbonyl)-2-nitrobenzoate |