Diosbulbin B structure
|
Common Name | Diosbulbin B | ||
|---|---|---|---|---|
| CAS Number | 20086-06-0 | Molecular Weight | 344.358 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 574.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.4±30.1 °C | |
Use of Diosbulbin BDiosbulbin B is a diterpene lactone isolated from D. bulbifera L., with anti-tumor activity. Diosbulbin B can induce liver injury[1][2]. |
| Name | Diosbulbin B |
|---|---|
| Synonym | More Synonyms |
| Description | Diosbulbin B is a diterpene lactone isolated from D. bulbifera L., with anti-tumor activity. Diosbulbin B can induce liver injury[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.8±50.0 °C at 760 mmHg |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.358 |
| Flash Point | 301.4±30.1 °C |
| Exact Mass | 344.125977 |
| PSA | 74.97000 |
| LogP | -0.41 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | QEANLIISUSNNDX-OURBUMGBSA-N |
| SMILES | CC12CC(c3ccoc3)OC13CC(OC3=O)C1C3CC(CC12)OC3=O |
| Storage condition | 2-8C |
| Hexaaethoxy-aethan |
| diorthooxalic acid hexaethyl ester |
| Hexaaethoxy-aethan [German] |
| (1S,3R,5S,6R,8R,11R,12S,13S)-3-(3-Furyl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.1.0.0]heptadecane-10,15-dione |
| Hexaethoxyethane |
| Ethane,hexaethoxy |
| Diorthooxalsaeure-hexaaethylester |
| Diosbulbin-B |
| Hexaethoxy-ethan |
| 4H-3a,6:7,10-Dimethanofuro[2,3-c]oxepino[4,5-e]oxepin-4,8(6H)-dione, 2-(3-furanyl)octahydro-11b-methyl-, (2R,3aS,6S,6aS,7R,10R,11aR,11bS)- |