ethyl N-[3,5-bis(trifluoromethyl)phenyl]carbamate structure
|
Common Name | ethyl N-[3,5-bis(trifluoromethyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1998-88-5 | Molecular Weight | 301.18500 | |
| Density | 1.417g/cm3 | Boiling Point | 208.3ºC at 760 mmHg | |
| Molecular Formula | C11H9F6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.8ºC | |
| Name | ethyl N-[3,5-bis(trifluoromethyl)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 208.3ºC at 760 mmHg |
| Molecular Formula | C11H9F6NO2 |
| Molecular Weight | 301.18500 |
| Flash Point | 79.8ºC |
| Exact Mass | 301.05400 |
| PSA | 38.33000 |
| LogP | 4.36560 |
| Vapour Pressure | 0.215mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | YKCQHKCQSDPUOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|
~%
ethyl N-[3,5-bi... CAS#:1998-88-5 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms563d13 |