Stannane, tetracyclopentyl-
Modify Date: 2025-08-26 17:54:27
Stannane, tetracyclopentyl- structure
|
Common Name | Stannane, tetracyclopentyl- | ||
|---|---|---|---|---|
| CAS Number | 19962-46-0 | Molecular Weight | 395.20100 | |
| Density | N/A | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C20H36Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | tetracyclopentylstannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 417.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H36Sn |
| Molecular Weight | 395.20100 |
| Flash Point | 209.7ºC |
| Exact Mass | 396.18400 |
| LogP | 7.21200 |
| Vapour Pressure | 8.35E-07mmHg at 25°C |
| InChIKey | MGQMTIKCGKXQMD-UHFFFAOYSA-N |
| SMILES | C1CCC([Sn](C2CCCC2)(C2CCCC2)C2CCCC2)C1 |
| HS Code | 2931900090 |
|---|
|
~%
Stannane, tetra... CAS#:19962-46-0 |
| Literature: Gmelin Handbook: Sn: Org.Verb.1, 1.1.1.12, page 121 - 122 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Sn(cyclopentyl)4 |
| Stannane,tetracyclopentyl |