2-(Perfluorooctyl)ethyl methacrylate structure
|
Common Name | 2-(Perfluorooctyl)ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 1996-88-9 | Molecular Weight | 532.193 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 251.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H9F17O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 103.1±22.2 °C | |
| Symbol |
GHS05, GHS08 |
Signal Word | Danger | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.9±40.0 °C at 760 mmHg |
| Molecular Formula | C14H9F17O2 |
| Molecular Weight | 532.193 |
| Flash Point | 103.1±22.2 °C |
| Exact Mass | 532.033081 |
| PSA | 26.30000 |
| LogP | 8.49 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.326 |
| InChIKey | HBZFBSFGXQBQTB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | Keep Cold |
| Symbol |
GHS05, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317-H334 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34;R42/43 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916140000 |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| heptadecafluorodecyl methacrylate |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heptadecafluorodecyl methacrylate |
| 1H,1H,2H,2H-Heptadecafluorodecyl methacrylate |
| 1h,1h,2h,2h-perfluorodecyl methacrylate |
| Perfluorooctyl-ethylene methycrylate |
| MFCD00042307 |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl methacrylate |
| 2-Propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl ester |
| EINECS 217-877-2 |
| 2-(Perfluorooctyl)ethyl methacrylate |