Asoprisnil structure
|
Common Name | Asoprisnil | ||
|---|---|---|---|---|
| CAS Number | 199396-76-4 | Molecular Weight | 449.58200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H35NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AsoprisnilAsoprisnil (J867), a selective progesterone receptor modulator, exhibits mixed progesterone agonist and antagonist effects on various progesterone targeted tissues in animal and human[1]. |
| Name | (8S,11R,13S,14S,17S)-11-[4-[(E)-hydroxyiminomethyl]phenyl]-17-methoxy-17-(methoxymethyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Asoprisnil (J867), a selective progesterone receptor modulator, exhibits mixed progesterone agonist and antagonist effects on various progesterone targeted tissues in animal and human[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H35NO4 |
|---|---|
| Molecular Weight | 449.58200 |
| Exact Mass | 449.25700 |
| PSA | 68.12000 |
| LogP | 5.42580 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | GJMNAFGEUJBOCE-MEQIQULJSA-N |
| SMILES | COCC1(OC)CCC2C3CCC4=CC(=O)CCC4=C3C(c3ccc(C=NO)cc3)CC21C |
| J867 |
| Benzaldehyde,4-((11beta,17beta)-17-methoxy-17-(methoxymethyl)-3-oxoestra-4,9-dien-11-yl)-,1-oxime,(C(E)) |
| Asoprisnil |
| 11beta-(4-((E)-(Hydroxyimino)methyl)phenyl)-17beta-methoxy-17-(methoxymethyl)estra-4,9-dien-3-one |
| Asoprisnil (USAN/INN) |