2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE structure
|
Common Name | 2,5-DI-TERT-BUTYL-4-HYDROXYANISOLE | ||
|---|---|---|---|---|
| CAS Number | 1991-52-2 | Molecular Weight | 236.35000 | |
| Density | 0.963 g/cm3 | Boiling Point | 337.8ºC at 760 mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | 99-102ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 129.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-ditert-butyl-4-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.963 g/cm3 |
|---|---|
| Boiling Point | 337.8ºC at 760 mmHg |
| Melting Point | 99-102ºC(lit.) |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 129.2ºC |
| Exact Mass | 236.17800 |
| PSA | 29.46000 |
| LogP | 3.99580 |
| Appearance of Characters | Crystalline Powder,White to cream |
| Vapour Pressure | 5.25E-05mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | FLLRQABPKFCXSO-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)(C)C)c(O)cc1C(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2909500000 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Catalytic activity of anion-exchange resins modified with metal-porphine in oxidative reactions of phenols.
Chem. Pharm. Bull. 48(11) , 1831-2, (2000) Anion-exchange resins modified with metal-porphine (M-Pr) have been investigated to develop a solid catalyst in the oxidative reaction of phenols by O2 in air. Co-Pr, which is easily prepared and sepa... |
|
|
Protective effects of butylated hydroxyanisole and its analogs on the lung toxicity of butylated hydroxytoluene in mice.
Res. Commun. Chem. Pathol. Pharmacol. 50(1) , 125-33, (1985) Dietary administration of butylated hydroxyanisole (BHA) and its analogs, 2-tert-butyl-1,4-dimethoxybenzene, 2,5-di-tert-butyl-4-methoxyphenol, and 2,6-di-tert-butyl-4-methoxyphenol resulted in comple... |
|
|
Sensitive high-performance liquid chromatographic method for the routine determination of butylated hydroxyanisole in plasma.
J. Chromatogr. A. 413 , 282-6, (1987)
|
| 2,5-di-tert.-butylhydroquinone monomethyl ether |
| 2,5-Di-tert-butyl-4-methoxy-phenol |
| MFCD00274238 |
| 5-Hydroxy-2-methoxy-1.4-di-tert.-butyl-benzol |
| EINECS 217-873-0 |
| 4-methoxy-3,6-di-tert-butylphenol |
| 2,5-Di-t-butyl-4-methoxyphenol |
| 2,5-Di-tert-butyl-4-hydroxyanisole |